C14H26Cl2N4O — CID 119874666
4-(methylamino)-N-[4-(pyridin-2-ylamino)butyl]butanamide;dihydrochloride (PubChem CID 119874666) has the molecular formula C14H26Cl2N4O and a molecular weight of 337.30 g/mol. Its IUPAC name is 4-(methylamino)-N-[4-(pyridin-2-ylamino)butyl]butanamide;dihydrochloride.
| Compound Name | 4-(methylamino)-N-[4-(pyridin-2-ylamino)butyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119874666 |
| Molecular Formula | C14H26Cl2N4O |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-(methylamino)-N-[4-(pyridin-2-ylamino)butyl]butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCCCCNc1ccccn1.Cl.Cl |
| InChI | InChI=1S/C14H24N4O.2ClH/c1-15-9-6-8-14(19)18-12-5-4-11-17-13-7-2-3-10-16-13;;/h2-3,7,10,15H,4-6,8-9,11-12H2,1H3,(H,16,17)(H,18,19);2*1H |
| InChIKey | BJXRMNULIYCPQP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|