C21H31N5O2 — CID 86573875
(2S)-2-amino-4-methyl-N-[(2S)-1-oxo-1-[3-(quinolin-4-ylamino)propylamino]propan-2-yl]pentanamide (PubChem CID 86573875) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(2S)-1-oxo-1-[3-(quinolin-4-ylamino)propylamino]propan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(2S)-1-oxo-1-[3-(quinolin-4-ylamino)propylamino]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 86573875 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(2S)-1-oxo-1-[3-(quinolin-4-ylamino)propylamino]propan-2-yl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](C)C(=O)NCCCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H31N5O2/c1-14(2)13-17(22)21(28)26-15(3)20(27)25-11-6-10-23-19-9-12-24-18-8-5-4-7-16(18)19/h4-5,7-9,12,14-15,17H,6,10-11,13,22H2,1-3H3,(H,23,24)(H,25,27)(H,26,28)/t15-,17-/m0/s1 |
| InChIKey | YKOSPTGAXUZAHU-RDJZCZTQSA-N |
| XLogP | 2.03 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|