C12H22F3N3O2 — CID 111438270
1-[(1-hydroxycyclobutyl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea (PubChem CID 111438270) has the molecular formula C12H22F3N3O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 1-[(1-hydroxycyclobutyl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea.
| Compound Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
|---|---|
| PubChem CID | 111438270 |
| Molecular Formula | C12H22F3N3O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[(1-hydroxycyclobutyl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]urea |
| SMILES | CN(CCCNC(=O)NCC1(O)CCC1)CC(F)(F)F |
| InChI | InChI=1S/C12H22F3N3O2/c1-18(9-12(13,14)15)7-3-6-16-10(19)17-8-11(20)4-2-5-11/h20H,2-9H2,1H3,(H2,16,17,19) |
| InChIKey | YFWXCQMLBZXVJA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|