C11H19F3N2O — CID 51080880
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclobutanecarboxamide (PubChem CID 51080880) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 51080880 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]cyclobutanecarboxamide |
| SMILES | CN(CCCNC(=O)C1CCC1)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-16(8-11(12,13)14)7-3-6-15-10(17)9-4-2-5-9/h9H,2-8H2,1H3,(H,15,17) |
| InChIKey | IMUWEXRXRYNUGC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|