C18H24F3N5O — CID 46481936
1-(5-cyano-2-pyridinyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperidine-4-carboxamide (PubChem CID 46481936) has the molecular formula C18H24F3N5O and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-(5-cyano-2-pyridinyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-cyano-2-pyridinyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46481936 |
| Molecular Formula | C18H24F3N5O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-(5-cyano-2-pyridinyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperidine-4-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCN(c2ccc(C#N)cn2)CC1)CC(F)(F)F |
| InChI | InChI=1S/C18H24F3N5O/c1-25(13-18(19,20)21)8-2-7-23-17(27)15-5-9-26(10-6-15)16-4-3-14(11-22)12-24-16/h3-4,12,15H,2,5-10,13H2,1H3,(H,23,27) |
| InChIKey | RCNBNQBEBUUNND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|