C16H23F3N4O — CID 75196091
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-5-phenylpyrazolidine-3-carboxamide (PubChem CID 75196091) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-5-phenylpyrazolidine-3-carboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-5-phenylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75196091 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-5-phenylpyrazolidine-3-carboxamide |
| SMILES | CN(CCCNC(=O)C1CC(c2ccccc2)NN1)CC(F)(F)F |
| InChI | InChI=1S/C16H23F3N4O/c1-23(11-16(17,18)19)9-5-8-20-15(24)14-10-13(21-22-14)12-6-3-2-4-7-12/h2-4,6-7,13-14,21-22H,5,8-11H2,1H3,(H,20,24) |
| InChIKey | KNZWJSLICKLOBX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|