C22H32F3N3O3S — CID 55720513
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 55720513) has the molecular formula C22H32F3N3O3S and a molecular weight of 475.58 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55720513 |
| Molecular Formula | C22H32F3N3O3S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1)CC(F)(F)F |
| InChI | InChI=1S/C22H32F3N3O3S/c1-27(16-22(23,24)25)12-4-11-26-21(29)18-9-13-28(14-10-18)32(30,31)20-8-7-17-5-2-3-6-19(17)15-20/h7-8,15,18H,2-6,9-14,16H2,1H3,(H,26,29) |
| InChIKey | WVBFMZGKZRBHKA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|