C15H20N2O4S — CID 25358979
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 25358979) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25358979 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C(NO)C1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C15H20N2O4S/c18-15(16-19)12-6-8-17(9-7-12)22(20,21)14-5-4-11-2-1-3-13(11)10-14/h4-5,10,12,19H,1-3,6-9H2,(H,16,18) |
| InChIKey | JNYIEBBLUKCAAW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|