C26H41N3O3S — CID 51960514
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]piperidine-4-carboxamide (PubChem CID 51960514) has the molecular formula C26H41N3O3S and a molecular weight of 475.70 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51960514 |
| Molecular Formula | C26H41N3O3S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]piperidine-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCCNC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)C1 |
| InChI | InChI=1S/C26H41N3O3S/c1-20-16-21(2)19-28(18-20)13-4-3-12-27-26(30)23-10-14-29(15-11-23)33(31,32)25-9-8-22-6-5-7-24(22)17-25/h8-9,17,20-21,23H,3-7,10-16,18-19H2,1-2H3,(H,27,30)/t20-,21-/m1/s1 |
| InChIKey | CKYHERCRILDXBA-NHCUHLMSSA-N |
| XLogP | 3.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|