C17H25F3N4O2 — CID 51116577
N,N,4-trimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide (PubChem CID 51116577) has the molecular formula C17H25F3N4O2 and a molecular weight of 374.41 g/mol. Its IUPAC name is N,N,4-trimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide.
| Compound Name | N,N,4-trimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 51116577 |
| Molecular Formula | C17H25F3N4O2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N,N,4-trimethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propylcarbamoylamino]benzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NC(=O)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C17H25F3N4O2/c1-12-6-7-13(15(25)23(2)3)10-14(12)22-16(26)21-8-5-9-24(4)11-17(18,19)20/h6-7,10H,5,8-9,11H2,1-4H3,(H2,21,22,26) |
| InChIKey | FSDPSEQHBDFVGH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|