C16H25N3O2 — CID 47041438
N,N,4-trimethyl-3-(pentan-2-ylcarbamoylamino)benzamide (PubChem CID 47041438) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N,N,4-trimethyl-3-(pentan-2-ylcarbamoylamino)benzamide.
| Compound Name | N,N,4-trimethyl-3-(pentan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 47041438 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N,N,4-trimethyl-3-(pentan-2-ylcarbamoylamino)benzamide |
| SMILES | CCCC(C)NC(=O)Nc1cc(C(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C16H25N3O2/c1-6-7-12(3)17-16(21)18-14-10-13(9-8-11(14)2)15(20)19(4)5/h8-10,12H,6-7H2,1-5H3,(H2,17,18,21) |
| InChIKey | ARLOTDVJHVDBST-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |