About 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide
3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide (PubChem CID 80543366) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide.
Molecular Properties
| Compound Name | 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide |
| PubChem CID | 80543366 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NC(=O)C(C)CCN |
| InChI | InChI=1S/C15H23N3O2/c1-10-5-6-12(15(20)18(3)4)9-13(10)17-14(19)11(2)7-8-16/h5-6,9,11H,7-8,16H2,1-4H3,(H,17,19) |
| InChIKey | WTDZXSULSCKWSE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide?
The IUPAC name of 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide (CID 80543366) is 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide.
What is the SMILES notation for 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide?
The canonical SMILES for 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide is Cc1ccc(C(=O)N(C)C)cc1NC(=O)C(C)CCN.
What is the InChIKey of 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide?
The InChIKey is WTDZXSULSCKWSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-10-5-6-12(15(20)18(3)4)9-13(10)17-14(19)11(2)7-8-16/h5-6,9,11H,7-8,16H2,1-4H3,(H,17,19).
What are the key properties of 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide?
3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide has a molecular weight of 277.37 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide is sourced from PubChem (CID 80543366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).