C15H23N3O2 — CID 80543366
3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide (PubChem CID 80543366) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide.
| Compound Name | 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide |
|---|---|
| PubChem CID | 80543366 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-[(4-amino-2-methylbutanoyl)amino]-N,N,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NC(=O)C(C)CCN |
| InChI | InChI=1S/C15H23N3O2/c1-10-5-6-12(15(20)18(3)4)9-13(10)17-14(19)11(2)7-8-16/h5-6,9,11H,7-8,16H2,1-4H3,(H,17,19) |
| InChIKey | WTDZXSULSCKWSE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |