C16H25N3O2 — CID 61179468
3-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N,N,4-trimethylbenzamide (PubChem CID 61179468) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N,N,4-trimethylbenzamide.
| Compound Name | 3-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N,N,4-trimethylbenzamide |
|---|---|
| PubChem CID | 61179468 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-N,N,4-trimethylbenzamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1cc(C(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C16H25N3O2/c1-6-10(2)14(17)15(20)18-13-9-12(8-7-11(13)3)16(21)19(4)5/h7-10,14H,6,17H2,1-5H3,(H,18,20)/t10-,14-/m0/s1 |
| InChIKey | YSXDNJWSWYNRTB-HZMBPMFUSA-N |
| XLogP | 2.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |