C15H23N3O2 — CID 61154615
(2S,3S)-N-(5-acetamido-2-methylphenyl)-2-amino-3-methylpentanamide (PubChem CID 61154615) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (2S,3S)-N-(5-acetamido-2-methylphenyl)-2-amino-3-methylpentanamide.
| Compound Name | (2S,3S)-N-(5-acetamido-2-methylphenyl)-2-amino-3-methylpentanamide |
|---|---|
| PubChem CID | 61154615 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2S,3S)-N-(5-acetamido-2-methylphenyl)-2-amino-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1cc(NC(C)=O)ccc1C |
| InChI | InChI=1S/C15H23N3O2/c1-5-9(2)14(16)15(20)18-13-8-12(17-11(4)19)7-6-10(13)3/h6-9,14H,5,16H2,1-4H3,(H,17,19)(H,18,20)/t9-,14-/m0/s1 |
| InChIKey | QTISBJBWIDVSEY-XPTSAGLGSA-N |
| XLogP | 2.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |