C15H25N3O3S2 — CID 43077250
1-(4-ethoxyphenyl)-3-[3-[ethylsulfonyl(methyl)amino]propyl]thiourea (PubChem CID 43077250) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[3-[ethylsulfonyl(methyl)amino]propyl]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[3-[ethylsulfonyl(methyl)amino]propyl]thiourea |
|---|---|
| PubChem CID | 43077250 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[3-[ethylsulfonyl(methyl)amino]propyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)NCCCN(C)S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C15H25N3O3S2/c1-4-21-14-9-7-13(8-10-14)17-15(22)16-11-6-12-18(3)23(19,20)5-2/h7-10H,4-6,11-12H2,1-3H3,(H2,16,17,22) |
| InChIKey | IJOVYUXBVHSXDY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|