C16H27N3O3S2 — CID 43077238
1-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[2-(4-methoxyphenyl)ethyl]thiourea (PubChem CID 43077238) has the molecular formula C16H27N3O3S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[2-(4-methoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[2-(4-methoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 43077238 |
| Molecular Formula | C16H27N3O3S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-3-[2-(4-methoxyphenyl)ethyl]thiourea |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=S)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H27N3O3S2/c1-4-24(20,21)19(2)13-5-11-17-16(23)18-12-10-14-6-8-15(22-3)9-7-14/h6-9H,4-5,10-13H2,1-3H3,(H2,17,18,23) |
| InChIKey | ZLUJLPIGEGEFBB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|