C28H34N4O2S2 — CID 16553986
1-[2-(4-methoxyphenyl)ethyl]-3-[[3-[[2-(4-methoxyphenyl)ethylcarbamothioylamino]methyl]phenyl]methyl]thiourea (PubChem CID 16553986) has the molecular formula C28H34N4O2S2 and a molecular weight of 522.74 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-[[3-[[2-(4-methoxyphenyl)ethylcarbamothioylamino]methyl]phenyl]methyl]thiourea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[[3-[[2-(4-methoxyphenyl)ethylcarbamothioylamino]methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 16553986 |
| Molecular Formula | C28H34N4O2S2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-[[3-[[2-(4-methoxyphenyl)ethylcarbamothioylamino]methyl]phenyl]methyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NCc2cccc(CNC(=S)NCCc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H34N4O2S2/c1-33-25-10-6-21(7-11-25)14-16-29-27(35)31-19-23-4-3-5-24(18-23)20-32-28(36)30-17-15-22-8-12-26(34-2)13-9-22/h3-13,18H,14-17,19-20H2,1-2H3,(H2,29,31,35)(H2,30,32,36) |
| InChIKey | MZIFDUXLZPCBQD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|