C26H31N3O3S — CID 15713918
1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]thiourea (PubChem CID 15713918) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 15713918 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]thiourea |
| SMILES | COc1cc(CNC(=S)NCCc2ccc(OCc3ccccc3)cc2)ccc1OCCN |
| InChI | InChI=1S/C26H31N3O3S/c1-30-25-17-22(9-12-24(25)31-16-14-27)18-29-26(33)28-15-13-20-7-10-23(11-8-20)32-19-21-5-3-2-4-6-21/h2-12,17H,13-16,18-19,27H2,1H3,(H2,28,29,33) |
| InChIKey | DLIQMAJTXGIWMG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|