C19H23Cl2N3O2S — CID 10670187
1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(2,4-dichlorophenyl)ethyl]thiourea (PubChem CID 10670187) has the molecular formula C19H23Cl2N3O2S and a molecular weight of 428.39 g/mol. Its IUPAC name is 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(2,4-dichlorophenyl)ethyl]thiourea.
| Compound Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(2,4-dichlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 10670187 |
| Molecular Formula | C19H23Cl2N3O2S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-[[4-(2-aminoethoxy)-3-methoxyphenyl]methyl]-3-[2-(2,4-dichlorophenyl)ethyl]thiourea |
| SMILES | COc1cc(CNC(=S)NCCc2ccc(Cl)cc2Cl)ccc1OCCN |
| InChI | InChI=1S/C19H23Cl2N3O2S/c1-25-18-10-13(2-5-17(18)26-9-7-22)12-24-19(27)23-8-6-14-3-4-15(20)11-16(14)21/h2-5,10-11H,6-9,12,22H2,1H3,(H2,23,24,27) |
| InChIKey | QNWOXYYMDJVEGG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|