C20H22Cl2N2O3S — CID 46762566
N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2,4-dichlorobenzamide (PubChem CID 46762566) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2,4-dichlorobenzamide.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 46762566 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2,4-dichlorobenzamide |
| SMILES | CCCCOc1ccc(CNC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C20H22Cl2N2O3S/c1-3-4-9-27-17-8-5-13(10-18(17)26-2)12-23-20(28)24-19(25)15-7-6-14(21)11-16(15)22/h5-8,10-11H,3-4,9,12H2,1-2H3,(H2,23,24,25,28) |
| InChIKey | HQNXVVOIMXOEIX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|