C24H30N2O4S — CID 46762691
(E)-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 46762691) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is (E)-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46762691 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (E)-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(CNC(=S)NC(=O)/C=C/c2ccc(OCC)cc2)cc1OC |
| InChI | InChI=1S/C24H30N2O4S/c1-4-6-15-30-21-13-9-19(16-22(21)28-3)17-25-24(31)26-23(27)14-10-18-7-11-20(12-8-18)29-5-2/h7-14,16H,4-6,15,17H2,1-3H3,(H2,25,26,27,31)/b14-10+ |
| InChIKey | JPRAYLQEXATSNH-GXDHUFHOSA-N |
| XLogP | 4.48 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|