C21H26Cl2N2O3 — CID 55931317
2,4-dichloro-N-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]benzamide (PubChem CID 55931317) has the molecular formula C21H26Cl2N2O3 and a molecular weight of 425.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55931317 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2,4-dichloro-N-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]benzamide |
| SMILES | CCN(CC)CCOc1ccc(CNC(=O)c2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C21H26Cl2N2O3/c1-4-25(5-2)10-11-28-19-9-6-15(12-20(19)27-3)14-24-21(26)17-8-7-16(22)13-18(17)23/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,24,26) |
| InChIKey | DRZDCCIACCBENS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |