C24H23Cl2NO4 — CID 142875477
5-chloro-2-(2-chloroethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 142875477) has the molecular formula C24H23Cl2NO4 and a molecular weight of 460.36 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 5-chloro-2-(2-chloroethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 142875477 |
| Molecular Formula | C24H23Cl2NO4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 5-chloro-2-(2-chloroethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(Cl)ccc2OCCCl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H23Cl2NO4/c1-29-23-13-18(7-9-22(23)31-16-17-5-3-2-4-6-17)15-27-24(28)20-14-19(26)8-10-21(20)30-12-11-25/h2-10,13-14H,11-12,15-16H2,1H3,(H,27,28) |
| InChIKey | ABULWFSUKFZBNM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|