C26H35BrN2O4S — CID 46762654
5-bromo-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2-hexoxybenzamide (PubChem CID 46762654) has the molecular formula C26H35BrN2O4S and a molecular weight of 551.55 g/mol. Its IUPAC name is 5-bromo-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 46762654 |
| Molecular Formula | C26H35BrN2O4S |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 5-bromo-N-[(4-butoxy-3-methoxyphenyl)methylcarbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NC(=S)NCc1ccc(OCCCC)c(OC)c1 |
| InChI | InChI=1S/C26H35BrN2O4S/c1-4-6-8-9-15-32-22-13-11-20(27)17-21(22)25(30)29-26(34)28-18-19-10-12-23(24(16-19)31-3)33-14-7-5-2/h10-13,16-17H,4-9,14-15,18H2,1-3H3,(H2,28,29,30,34) |
| InChIKey | OECKWULNRXUMKA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|