C24H32BrNO4 — CID 54776790
5-bromo-2-butoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]benzamide (PubChem CID 54776790) has the molecular formula C24H32BrNO4 and a molecular weight of 478.43 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 54776790 |
| Molecular Formula | C24H32BrNO4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NCc1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H32BrNO4/c1-5-6-12-29-21-10-8-19(25)15-20(21)24(27)26-16-18-7-9-22(23(14-18)28-4)30-13-11-17(2)3/h7-10,14-15,17H,5-6,11-13,16H2,1-4H3,(H,26,27) |
| InChIKey | VDTXNOSMOZNLPL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|