C19H21BrN2O4S — CID 17230582
5-bromo-2-(2-methoxyethoxy)-N-[(4-methoxyphenyl)methylcarbamothioyl]benzamide (PubChem CID 17230582) has the molecular formula C19H21BrN2O4S and a molecular weight of 453.36 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-[(4-methoxyphenyl)methylcarbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-[(4-methoxyphenyl)methylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 17230582 |
| Molecular Formula | C19H21BrN2O4S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-[(4-methoxyphenyl)methylcarbamothioyl]benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21BrN2O4S/c1-24-9-10-26-17-8-5-14(20)11-16(17)18(23)22-19(27)21-12-13-3-6-15(25-2)7-4-13/h3-8,11H,9-10,12H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | ZXJUFEIWUNGKPM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|