C22H27ClN2O4S — CID 54785731
N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-pentoxybenzamide (PubChem CID 54785731) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 54785731 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)NCc1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C22H27ClN2O4S/c1-4-5-8-11-29-18-10-7-6-9-16(18)21(26)25-22(30)24-14-15-12-19(27-2)20(28-3)13-17(15)23/h6-7,9-10,12-13H,4-5,8,11,14H2,1-3H3,(H2,24,25,26,30) |
| InChIKey | GABUINRCHIWBJQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|