C25H25ClN2O5S — CID 54785753
N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 54785753) has the molecular formula C25H25ClN2O5S and a molecular weight of 501.00 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54785753 |
| Molecular Formula | C25H25ClN2O5S |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | COc1cc(Cl)c(CNC(=S)NC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H25ClN2O5S/c1-30-22-14-18(21(26)15-23(22)31-2)16-27-25(34)28-24(29)17-8-10-20(11-9-17)33-13-12-32-19-6-4-3-5-7-19/h3-11,14-15H,12-13,16H2,1-2H3,(H2,27,28,29,34) |
| InChIKey | GVCAGNPVBYCBLP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|