C19H20ClNO4 — CID 54785453
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-prop-2-enoxybenzamide (PubChem CID 54785453) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 54785453 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCc2cc(OC)c(OC)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO4/c1-4-9-25-15-7-5-13(6-8-15)19(22)21-12-14-10-17(23-2)18(24-3)11-16(14)20/h4-8,10-11H,1,9,12H2,2-3H3,(H,21,22) |
| InChIKey | ZWNOANJXROWYKF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|