C18H17Cl2NO2 — CID 21367878
N-[(2,4-dichlorophenyl)methyl]-4-methoxy-3-prop-2-enylbenzamide (PubChem CID 21367878) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-4-methoxy-3-prop-2-enylbenzamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-4-methoxy-3-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 21367878 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-4-methoxy-3-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCc2ccc(Cl)cc2Cl)ccc1OC |
| InChI | InChI=1S/C18H17Cl2NO2/c1-3-4-12-9-13(6-8-17(12)23-2)18(22)21-11-14-5-7-15(19)10-16(14)20/h3,5-10H,1,4,11H2,2H3,(H,21,22) |
| InChIKey | AJEINCQBILDHIE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|