C26H34Cl2N2O6 — CID 54786049
N,N'-bis[(2-chloro-4,5-dimethoxyphenyl)methyl]octanediamide (PubChem CID 54786049) has the molecular formula C26H34Cl2N2O6 and a molecular weight of 541.47 g/mol. Its IUPAC name is N,N'-bis[(2-chloro-4,5-dimethoxyphenyl)methyl]octanediamide.
| Compound Name | N,N'-bis[(2-chloro-4,5-dimethoxyphenyl)methyl]octanediamide |
|---|---|
| PubChem CID | 54786049 |
| Molecular Formula | C26H34Cl2N2O6 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N,N'-bis[(2-chloro-4,5-dimethoxyphenyl)methyl]octanediamide |
| SMILES | COc1cc(Cl)c(CNC(=O)CCCCCCC(=O)NCc2cc(OC)c(OC)cc2Cl)cc1OC |
| InChI | InChI=1S/C26H34Cl2N2O6/c1-33-21-11-17(19(27)13-23(21)35-3)15-29-25(31)9-7-5-6-8-10-26(32)30-16-18-12-22(34-2)24(36-4)14-20(18)28/h11-14H,5-10,15-16H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | BLIDRTNLYMHBSW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|