C17H23ClN2O3S — CID 54785826
N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]cyclohexanecarboxamide (PubChem CID 54785826) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 54785826 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]cyclohexanecarboxamide |
| SMILES | COc1cc(Cl)c(CNC(=S)NC(=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H23ClN2O3S/c1-22-14-8-12(13(18)9-15(14)23-2)10-19-17(24)20-16(21)11-6-4-3-5-7-11/h8-9,11H,3-7,10H2,1-2H3,(H2,19,20,21,24) |
| InChIKey | OUCOUHFXUPQCFM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|