C23H29ClN2O3S — CID 54785831
N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54785831) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54785831 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | COc1cc(Cl)c(CNC(=S)NC(=O)C(C)c2ccc(CC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C23H29ClN2O3S/c1-14(2)10-16-6-8-17(9-7-16)15(3)22(27)26-23(30)25-13-18-11-20(28-4)21(29-5)12-19(18)24/h6-9,11-12,14-15H,10,13H2,1-5H3,(H2,25,26,27,30) |
| InChIKey | DLWZJZSLPZCBMY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|