C20H23ClN2O6S — CID 54785802
N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 54785802) has the molecular formula C20H23ClN2O6S and a molecular weight of 454.93 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 54785802 |
| Molecular Formula | C20H23ClN2O6S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methylcarbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(Cl)c(CNC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O6S/c1-25-14-8-12(13(21)9-15(14)26-2)10-22-20(30)23-19(24)11-6-16(27-3)18(29-5)17(7-11)28-4/h6-9H,10H2,1-5H3,(H2,22,23,24,30) |
| InChIKey | QJONEOZNZAWAOC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|