C12H15N3O5S — CID 2796467
N-(carbamoylcarbamothioyl)-3,4,5-trimethoxybenzamide (PubChem CID 2796467) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-(carbamoylcarbamothioyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(carbamoylcarbamothioyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2796467 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(carbamoylcarbamothioyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)NC(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C12H15N3O5S/c1-18-7-4-6(5-8(19-2)9(7)20-3)10(16)14-12(21)15-11(13)17/h4-5H,1-3H3,(H4,13,14,15,16,17,21) |
| InChIKey | FXVJDHHZSCFJNQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|