C20H23N3O7S — CID 3523041
N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 3523041) has the molecular formula C20H23N3O7S and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3523041 |
| Molecular Formula | C20H23N3O7S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[[(3,4-dimethoxybenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NNC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H23N3O7S/c1-26-13-7-6-11(8-14(13)27-2)19(25)22-23-20(31)21-18(24)12-9-15(28-3)17(30-5)16(10-12)29-4/h6-10H,1-5H3,(H,22,25)(H2,21,23,24,31) |
| InChIKey | RCTOEXKJSSIIRQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|