C17H16Cl2N2O5S — CID 5146034
N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 5146034) has the molecular formula C17H16Cl2N2O5S and a molecular weight of 431.30 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 5146034 |
| Molecular Formula | C17H16Cl2N2O5S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cc(Cl)c(O)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16Cl2N2O5S/c1-24-12-4-8(5-13(25-2)15(12)26-3)16(23)21-17(27)20-9-6-10(18)14(22)11(19)7-9/h4-7,22H,1-3H3,(H2,20,21,23,27) |
| InChIKey | YTVUFGSBZBFGMM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|