C14H9BrCl2N2O2S — CID 3260684
3-bromo-N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]benzamide (PubChem CID 3260684) has the molecular formula C14H9BrCl2N2O2S and a molecular weight of 420.12 g/mol. Its IUPAC name is 3-bromo-N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3260684 |
| Molecular Formula | C14H9BrCl2N2O2S |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 417.89 |
| IUPAC Name | 3-bromo-N-[(3,5-dichloro-4-hydroxyphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)c(O)c(Cl)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H9BrCl2N2O2S/c15-8-3-1-2-7(4-8)13(21)19-14(22)18-9-5-10(16)12(20)11(17)6-9/h1-6,20H,(H2,18,19,21,22) |
| InChIKey | GHSPYBQKWHFQHG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|