C24H26ClN3O5S — CID 130413262
N-[[4-chloro-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]carbamoyl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 130413262) has the molecular formula C24H26ClN3O5S and a molecular weight of 504.01 g/mol. Its IUPAC name is N-[[4-chloro-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]carbamoyl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-chloro-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]carbamoyl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 130413262 |
| Molecular Formula | C24H26ClN3O5S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[[4-chloro-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]carbamoyl]phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | C/C=C\C=C(/C)NC(=O)c1cc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1Cl |
| InChI | InChI=1S/C24H26ClN3O5S/c1-6-7-8-14(2)26-23(30)17-13-16(9-10-18(17)25)27-24(34)28-22(29)15-11-19(31-3)21(33-5)20(12-15)32-4/h6-13H,1-5H3,(H,26,30)(H2,27,28,29,34)/b7-6-,14-8+ |
| InChIKey | KOELIAVJNSZPPH-BHWOWGIZSA-N |
| XLogP | 4.70 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|