C18H19FN2O4S — CID 2731090
N-[(3-fluoro-4-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 2731090) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2731090 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(C)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19FN2O4S/c1-10-5-6-12(9-13(10)19)20-18(26)21-17(22)11-7-14(23-2)16(25-4)15(8-11)24-3/h5-9H,1-4H3,(H2,20,21,22,26) |
| InChIKey | HFOCDJKCENMZGH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|