C26H29N3O6S — CID 130413286
3,4,5-trimethoxy-N-[[4-methoxy-3-[[(3Z,5Z)-2-methylidenehepta-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide (PubChem CID 130413286) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-methoxy-3-[[(3Z,5Z)-2-methylidenehepta-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-methoxy-3-[[(3Z,5Z)-2-methylidenehepta-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 130413286 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-methoxy-3-[[(3Z,5Z)-2-methylidenehepta-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide |
| SMILES | C=C(/C=C\C=C/C)C(=O)Nc1cc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C26H29N3O6S/c1-7-8-9-10-16(2)24(30)28-19-15-18(11-12-20(19)32-3)27-26(36)29-25(31)17-13-21(33-4)23(35-6)22(14-17)34-5/h7-15H,2H2,1,3-6H3,(H,28,30)(H2,27,29,31,36)/b8-7-,10-9- |
| InChIKey | WIAJOKFWFRRSHF-QRLRYFCNSA-N |
| XLogP | 4.47 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|