C27H33N3O5S — CID 130413485
4-ethoxy-3,5-dimethoxy-N-[[4-methyl-3-[[(3Z,5Z)-octa-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide (PubChem CID 130413485) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is 4-ethoxy-3,5-dimethoxy-N-[[4-methyl-3-[[(3Z,5Z)-octa-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethoxy-3,5-dimethoxy-N-[[4-methyl-3-[[(3Z,5Z)-octa-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 130413485 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 4-ethoxy-3,5-dimethoxy-N-[[4-methyl-3-[[(3Z,5Z)-octa-3,5-dienoyl]amino]phenyl]carbamothioyl]benzamide |
| SMILES | CC/C=C\C=C/CC(=O)Nc1cc(NC(=S)NC(=O)c2cc(OC)c(OCC)c(OC)c2)ccc1C |
| InChI | InChI=1S/C27H33N3O5S/c1-6-8-9-10-11-12-24(31)29-21-17-20(14-13-18(21)3)28-27(36)30-26(32)19-15-22(33-4)25(35-7-2)23(16-19)34-5/h8-11,13-17H,6-7,12H2,1-5H3,(H,29,31)(H2,28,30,32,36)/b9-8-,11-10- |
| InChIKey | ZVXDSPJGBWDPRH-XESWYYRISA-N |
| XLogP | 5.39 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|