C23H29N3O4S — CID 90780123
N-[[4-(hexanoylamino)phenyl]carbamothioyl]-3,4-dimethoxy-5-methylbenzamide (PubChem CID 90780123) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[[4-(hexanoylamino)phenyl]carbamothioyl]-3,4-dimethoxy-5-methylbenzamide.
| Compound Name | N-[[4-(hexanoylamino)phenyl]carbamothioyl]-3,4-dimethoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 90780123 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[[4-(hexanoylamino)phenyl]carbamothioyl]-3,4-dimethoxy-5-methylbenzamide |
| SMILES | CCCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2cc(C)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-5-6-7-8-20(27)24-17-9-11-18(12-10-17)25-23(31)26-22(28)16-13-15(2)21(30-4)19(14-16)29-3/h9-14H,5-8H2,1-4H3,(H,24,27)(H2,25,26,28,31) |
| InChIKey | UELBDSDFUVHXKH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|