C21H24ClN3O3S — CID 91310284
3-chloro-N-[[4-(hexanoylamino)phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 91310284) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is 3-chloro-N-[[4-(hexanoylamino)phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3-chloro-N-[[4-(hexanoylamino)phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 91310284 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 3-chloro-N-[[4-(hexanoylamino)phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | CCCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24ClN3O3S/c1-3-4-5-6-19(26)23-15-8-10-16(11-9-15)24-21(29)25-20(27)14-7-12-18(28-2)17(22)13-14/h7-13H,3-6H2,1-2H3,(H,23,26)(H2,24,25,27,29) |
| InChIKey | YBLVFBIZAOXRRG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|