C21H24Cl2N2OS — CID 54782762
N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 54782762) has the molecular formula C21H24Cl2N2OS and a molecular weight of 423.41 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 54782762 |
| Molecular Formula | C21H24Cl2N2OS |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NC(=S)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2OS/c1-13(2)10-15-4-6-16(7-5-15)14(3)20(26)25-21(27)24-12-17-8-9-18(22)11-19(17)23/h4-9,11,13-14H,10,12H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | BQWPIYVADXIOAC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|