C18H19Cl2N3O2S — CID 2725843
N-[2-[(2,4-dichlorophenyl)methylcarbamothioylamino]ethyl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 2725843) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylcarbamothioylamino]ethyl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylcarbamothioylamino]ethyl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 2725843 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylcarbamothioylamino]ethyl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)NCCNC(=S)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O2S/c19-14-4-3-13(16(20)10-14)11-23-18(26)22-8-7-21-17(25)9-12-1-5-15(24)6-2-12/h1-6,10,24H,7-9,11H2,(H,21,25)(H2,22,23,26) |
| InChIKey | VDHMFGNGDIZSBS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|