C16H15Cl2FN2S — CID 3799200
1-[(2-chloro-4-fluorophenyl)methyl]-3-[2-(4-chlorophenyl)ethyl]thiourea (PubChem CID 3799200) has the molecular formula C16H15Cl2FN2S and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-3-[2-(4-chlorophenyl)ethyl]thiourea.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[2-(4-chlorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3799200 |
| Molecular Formula | C16H15Cl2FN2S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[2-(4-chlorophenyl)ethyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)NCCc2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2FN2S/c17-13-4-1-11(2-5-13)7-8-20-16(22)21-10-12-3-6-14(19)9-15(12)18/h1-6,9H,7-8,10H2,(H2,20,21,22) |
| InChIKey | DTCNGFMPSQOMNB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|