C17H15ClF4N2S — CID 3809296
1-[2-(4-chlorophenyl)ethyl]-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 3809296) has the molecular formula C17H15ClF4N2S and a molecular weight of 390.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3809296 |
| Molecular Formula | C17H15ClF4N2S |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | Fc1cc(CNC(=S)NCCc2ccc(Cl)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF4N2S/c18-14-3-1-11(2-4-14)5-6-23-16(25)24-10-12-7-13(17(20,21)22)9-15(19)8-12/h1-4,7-9H,5-6,10H2,(H2,23,24,25) |
| InChIKey | QOHAGKAPSHHGKH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|