C20H22F4N2S — CID 3854147
1-(4-butyl-2-methylphenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 3854147) has the molecular formula C20H22F4N2S and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(4-butyl-2-methylphenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(4-butyl-2-methylphenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3854147 |
| Molecular Formula | C20H22F4N2S |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(4-butyl-2-methylphenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NCc2cc(F)cc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C20H22F4N2S/c1-3-4-5-14-6-7-18(13(2)8-14)26-19(27)25-12-15-9-16(20(22,23)24)11-17(21)10-15/h6-11H,3-5,12H2,1-2H3,(H2,25,26,27) |
| InChIKey | MDMLBKYVRKBGOT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|