C15H10BrF5N2S — CID 3309595
1-(2-bromo-4-fluorophenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 3309595) has the molecular formula C15H10BrF5N2S and a molecular weight of 425.22 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3309595 |
| Molecular Formula | C15H10BrF5N2S |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | Fc1cc(CNC(=S)Nc2ccc(F)cc2Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10BrF5N2S/c16-12-6-10(17)1-2-13(12)23-14(24)22-7-8-3-9(15(19,20)21)5-11(18)4-8/h1-6H,7H2,(H2,22,23,24) |
| InChIKey | ITGFKVYFVVXJGP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|